Products 1190897-23-4
CAS 1190897-23-4 is the registry number for Phellolactone. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
[(3R,4R)-3,4-dihydroxy-5-oxooxolan-3-yl]methyl 4-hydroxy-3-methoxybenzoate (CAS 1190897-23-4) is a chemical compound with the molecular formula C13H14O8 and a molecular weight of 298.24 g/mol. IUPAC name: [(3R,4R)-3,4-dihydroxy-5-oxooxolan-3-yl]methyl 4-hydroxy-3-methoxybenzoate. InChIKey: XDFVRGIAOTYYJE-GXFFZTMASA-N.
| Molecular formula | C13H14O8 |
|---|---|
| Molecular weight | 298.24 g/mol |
| IUPAC name | [(3R,4R)-3,4-dihydroxy-5-oxooxolan-3-yl]methyl 4-hydroxy-3-methoxybenzoate |
| InChIKey | XDFVRGIAOTYYJE-GXFFZTMASA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC[C@]2(COC(=O)[C@@H]2O)O)O |
Computed by PubChem (NCBI)