CAS 1191-22-6 is the registry number for N6-Glycyl-L-lysine trifluoroacetate. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
N(6)-glycyl-L-lysine is a L-lysine derivative with a glycyl group at the N6-position. It is a L-lysine derivative and a non-proteinogenic L-alpha-amino acid.
Source: ChEBI
| Molecular formula | C8H17N3O3 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-amino-6-[(2-aminoacetyl)amino]hexanoic acid |
| InChIKey | YOYBPHLYMUAKGZ-LURJTMIESA-N |
| SMILES | C(CCNC(=O)CN)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)