CAS 1191079-83-0 appears in our catalog under these names: Amino-peg9-acid, 95%, Amino–PEG9–acid, Amino-PEG9-acid 95%, 1-Amino-3,6,9,12,15,18,21,24,27-nonaoxatriacontan-30-oic acid, 95%, 95%, Amino-PEG9-acid, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 25mg, 50mg, 5g, 100 mg, 5 g.
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1191079-83-0) is a chemical compound with the molecular formula C21H43NO11 and a molecular weight of 485.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ZYPBFSLIVZGGED-UHFFFAOYSA-N.
| Molecular formula | C21H43NO11 |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ZYPBFSLIVZGGED-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)