CAS 1191107-64-8 appears in our catalog under these names: 3-(1-(2,4-Difluorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid, 95%, 3-(1-(2,4-Difluorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-[1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid (CAS 1191107-64-8) is a chemical compound with the molecular formula C12H10F2N2O4 and a molecular weight of 284.22 g/mol. IUPAC name: 3-[1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid. InChIKey: PPLJSQCUFDWYHM-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2O4 |
|---|---|
| Molecular weight | 284.22 g/mol |
| IUPAC name | 3-[1-(2,4-difluorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| InChIKey | PPLJSQCUFDWYHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C(=O)C(NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)