CAS 119111-31-8 appears in our catalog under these names: (2R,3R,4S,5S,6S)–2–(Acetoxymethyl)–6–(allyloxy)tetrahydro–2H–pyran–3,4,5–triyl triacetate, Allyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2g, 10g, 25g.
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate (CAS 119111-31-8) is a chemical compound with the molecular formula C17H24O10 and a molecular weight of 388.4 g/mol. IUPAC name: [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate. InChIKey: CRUHDGOVWKFJBM-NRKLIOEPSA-N.
| Molecular formula | C17H24O10 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl]methyl acetate |
| InChIKey | CRUHDGOVWKFJBM-NRKLIOEPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OCC=C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)