Products 1191280-19-9

CAS 1191280-19-9 is the registry number for N-((3R)-3-(2-Methylphenoxy)-3-phenylpropyl)carbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3R)-3-(2-methylphenoxy)-3-phenylpropyl]carbamate (CAS 1191280-19-9) is a chemical compound with the molecular formula C21H27NO3 and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl N-[(3R)-3-(2-methylphenoxy)-3-phenylpropyl]carbamate. InChIKey: LXNOOWBTHTXIDQ-LJQANCHMSA-N.

Identity
Molecular formulaC21H27NO3
Molecular weight341.4 g/mol
IUPAC nametert-butyl N-[(3R)-3-(2-methylphenoxy)-3-phenylpropyl]carbamate
InChIKeyLXNOOWBTHTXIDQ-LJQANCHMSA-N
SMILESCC1=CC=CC=C1O[C@H](CCNC(=O)OC(C)(C)C)C2=CC=CC=C2

Computed by PubChem (NCBI)