Products 2766303-87-9
CAS 2766303-87-9 is the registry number for tert-Butyl (R)-benzyl(2-hydroxy-3-phenylpropyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-benzyl-N-[(2R)-2-hydroxy-3-phenylpropyl]carbamate (CAS 2766303-87-9) is a chemical compound with the molecular formula C21H27NO3 and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl N-benzyl-N-[(2R)-2-hydroxy-3-phenylpropyl]carbamate. InChIKey: KRMPONBSRGRBAI-LJQANCHMSA-N.
| Molecular formula | C21H27NO3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl N-benzyl-N-[(2R)-2-hydroxy-3-phenylpropyl]carbamate |
| InChIKey | KRMPONBSRGRBAI-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC=CC=C1)C[C@@H](CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)