CAS 119130-94-8 is the registry number for Potassium 1,3-benzoxazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Potassium 1,3-benzoxazole-2-carboxylate (CAS 119130-94-8) is a chemical compound with the molecular formula C8H4KNO3 and a molecular weight of 201.22 g/mol. IUPAC name: potassium 1,3-benzoxazole-2-carboxylate. InChIKey: BJRBWXXVOQASLD-UHFFFAOYSA-M.
| Molecular formula | C8H4KNO3 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | potassium 1,3-benzoxazole-2-carboxylate |
| InChIKey | BJRBWXXVOQASLD-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)