CAS 1191429-18-1 appears in our catalog under these names: (R)–8–Azido–2–(Fmoc–amino)octanoic acid, (R)-8-Azido-2-(Fmoc-amino)octanoic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, Get quote.
(2R)-8-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid (CAS 1191429-18-1) is a chemical compound with the molecular formula C23H26N4O4 and a molecular weight of 422.5 g/mol. IUPAC name: (2R)-8-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid. InChIKey: ORGUFSNMGCTGEA-OAQYLSRUSA-N.
| Molecular formula | C23H26N4O4 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | (2R)-8-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid |
| InChIKey | ORGUFSNMGCTGEA-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)