CAS 1191900-51-2 appears in our catalog under these names: Brexpiprazole Impurity 37, Brexpiprazole Sulfoxide, Brexpiprazole Impurity 20, Brexpiprazole S-Oxide, >95% (HPLC), Brexpiprazole S–oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
7-[4-[4-(1-oxo-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one (CAS 1191900-51-2) is a chemical compound with the molecular formula C25H27N3O3S and a molecular weight of 449.6 g/mol. IUPAC name: 7-[4-[4-(1-oxo-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one. InChIKey: VJYXYAVCCLPIPM-UHFFFAOYSA-N.
| Molecular formula | C25H27N3O3S |
|---|---|
| Molecular weight | 449.6 g/mol |
| IUPAC name | 7-[4-[4-(1-oxo-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1H-quinolin-2-one |
| InChIKey | VJYXYAVCCLPIPM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCOC2=CC3=C(C=C2)C=CC(=O)N3)C4=C5C=CS(=O)C5=CC=C4 |
Computed by PubChem (NCBI)