CAS 1191908-73-2 is the registry number for 6-Fluoro-3,4-dihydro-2H-thiochromen-4-amine 1,1-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride (CAS 1191908-73-2) is a chemical compound with the molecular formula C9H11ClFNO2S and a molecular weight of 251.71 g/mol. IUPAC name: 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride. InChIKey: HVJSNNFBPCOLLH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO2S |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride |
| InChIKey | HVJSNNFBPCOLLH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C(C1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)