Products 1192053-41-0
CAS 1192053-41-0 is the registry number for N-(3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1192053-41-0) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: JIMOCIKNQZJHRD-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | JIMOCIKNQZJHRD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)NC(=O)C)C |
Computed by PubChem (NCBI)