Products 119206-70-1
CAS 119206-70-1 appears in our catalog under these names: Chlorocyclohexane-d11, 98 atom % D, min 98% Chemical Purity, Chlorocyclohexane-d11. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane (CAS 119206-70-1) is a chemical compound with the molecular formula C6H11Cl and a molecular weight of 129.67 g/mol. IUPAC name: 1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane. InChIKey: UNFUYWDGSFDHCW-KAFHOZLVSA-N.
| Molecular formula | C6H11Cl |
|---|---|
| Molecular weight | 129.67 g/mol |
| IUPAC name | 1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane |
| InChIKey | UNFUYWDGSFDHCW-KAFHOZLVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])Cl)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)