CAS 1192364-53-6 is the registry number for 2,5,8,11-Tetramethyl Benzyl Ester Cyclen. Offered by: TRC. Available pack sizes: 100mg.
Benzyl (2S)-2-[(2S,5S,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10-tetrazacyclododec-1-yl]propanoate (CAS 1192364-53-6) is a chemical compound with the molecular formula C22H38N4O2 and a molecular weight of 390.6 g/mol. IUPAC name: benzyl (2S)-2-[(2S,5S,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10-tetrazacyclododec-1-yl]propanoate. InChIKey: PJVCHZSWKRAGOP-HVTWWXFQSA-N.
| Molecular formula | C22H38N4O2 |
|---|---|
| Molecular weight | 390.6 g/mol |
| IUPAC name | benzyl (2S)-2-[(2S,5S,8S,11S)-2,5,8,11-tetramethyl-1,4,7,10-tetrazacyclododec-1-yl]propanoate |
| InChIKey | PJVCHZSWKRAGOP-HVTWWXFQSA-N |
| SMILES | C[C@H]1CN[C@H](CN[C@H](CN([C@H](CN1)C)[C@@H](C)C(=O)OCC2=CC=CC=C2)C)C |
Computed by PubChem (NCBI)