CAS 1192411-43-0 is the registry number for PENAO, 96.65%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 5 mg, 10 mg.
(2S)-2-amino-3-[2-(4-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid (CAS 1192411-43-0) is a chemical compound with the molecular formula C13H19AsN2O5S and a molecular weight of 390.29 g/mol. IUPAC name: (2S)-2-amino-3-[2-(4-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid. InChIKey: BTIKNFALDXFWCX-NSHDSACASA-N.
| Molecular formula | C13H19AsN2O5S |
|---|---|
| Molecular weight | 390.29 g/mol |
| IUPAC name | (2S)-2-amino-3-[2-(4-dihydroxyarsanylanilino)-2-oxoethyl]sulfanyl-3-methylbutanoic acid |
| InChIKey | BTIKNFALDXFWCX-NSHDSACASA-N |
| SMILES | CC(C)([C@H](C(=O)O)N)SCC(=O)NC1=CC=C(C=C1)[As](O)O |
Computed by PubChem (NCBI)