CAS 1192590-89-8 appears in our catalog under these names: TAMRA azide, 6-isomer, 95%, TAMRA azide, 6–isomer, TAMRA azide, 6-isomer 95%, TAMRA azide, 6-isomer, 95%, 95%, 5-TAMRA-Azide, min. 95 %, 5 mg, plastic. Offered by: Lumiprobe, GLPBio, Ambeed, Chemat, Roth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
4-(3-azidopropylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate (CAS 1192590-89-8) is a chemical compound with the molecular formula C28H28N6O4 and a molecular weight of 512.6 g/mol. IUPAC name: 4-(3-azidopropylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate. InChIKey: LCCOWUGYZJZMIT-UHFFFAOYSA-N.
| Molecular formula | C28H28N6O4 |
|---|---|
| Molecular weight | 512.6 g/mol |
| IUPAC name | 4-(3-azidopropylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| InChIKey | LCCOWUGYZJZMIT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=CC(=C4)C(=O)NCCCN=[N+]=[N-])C(=O)[O-] |
Computed by PubChem (NCBI)