CAS 1192608-55-1 is the registry number for 1,1-Dimethylethyl (2S,3R)-3-amino-2-methyl-1-pyrrolidinecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (2S,3R)-3-amino-2-methylpyrrolidine-1-carboxylate (CAS 1192608-55-1) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl (2S,3R)-3-amino-2-methylpyrrolidine-1-carboxylate. InChIKey: WKBDQHQZEPPWBJ-JGVFFNPUSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-amino-2-methylpyrrolidine-1-carboxylate |
| InChIKey | WKBDQHQZEPPWBJ-JGVFFNPUSA-N |
| SMILES | C[C@H]1[C@@H](CCN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)