Products 1192758-40-9

CAS 1192758-40-9 is the registry number for 6-Morpholin-4-ylpyridazine-3-carboxylic acid hydrochloride hydrate, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.

Structural formula: {0} (CAS {1})

6-morpholin-4-ylpyridazine-3-carboxylic acid;hydrate;hydrochloride (CAS 1192758-40-9) is a chemical compound with the molecular formula C9H14ClN3O4 and a molecular weight of 263.68 g/mol. IUPAC name: 6-morpholin-4-ylpyridazine-3-carboxylic acid;hydrate;hydrochloride. InChIKey: VARLCSQEQQKXKH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClN3O4
Molecular weight263.68 g/mol
IUPAC name6-morpholin-4-ylpyridazine-3-carboxylic acid;hydrate;hydrochloride
InChIKeyVARLCSQEQQKXKH-UHFFFAOYSA-N
SMILESC1COCCN1C2=NN=C(C=C2)C(=O)O.O.Cl

Computed by PubChem (NCBI)