CAS 1192810-88-0 is the registry number for BMS-902483. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-N-isoquinolin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-amine (CAS 1192810-88-0) is a chemical compound with the molecular formula C18H20N4O and a molecular weight of 308.4 g/mol. IUPAC name: (3R)-N-isoquinolin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-amine. InChIKey: ZDTPXUKLGIDOCS-SFHVURJKSA-N.
| Molecular formula | C18H20N4O |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (3R)-N-isoquinolin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-amine |
| InChIKey | ZDTPXUKLGIDOCS-SFHVURJKSA-N |
| SMILES | C1CN2CCC1[C@@]3(C2)CN=C(O3)NC4=CC5=CC=CC=C5C=N4 |
Computed by PubChem (NCBI)