CAS 1193251-61-4 is the registry number for 5-Alkynyl-L-fucose. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
(3S,4R,5S,6S)-6-ethynyloxane-2,3,4,5-tetrol (CAS 1193251-61-4) is a chemical compound with the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. IUPAC name: (3S,4R,5S,6S)-6-ethynyloxane-2,3,4,5-tetrol. InChIKey: CZNHMTJHTGBOTL-DVEMRHSHSA-N.
| Molecular formula | C7H10O5 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | (3S,4R,5S,6S)-6-ethynyloxane-2,3,4,5-tetrol |
| InChIKey | CZNHMTJHTGBOTL-DVEMRHSHSA-N |
| SMILES | C#C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)O)O)O |
Computed by PubChem (NCBI)