Products 1193382-79-4
CAS 1193382-79-4 is the registry number for PHD2-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[6-(benzenesulfonyl)-5-chloro-1H-benzimidazol-2-yl]pyrazole-4-carboxylic acid (CAS 1193382-79-4) is a chemical compound with the molecular formula C17H11ClN4O4S and a molecular weight of 402.8 g/mol. IUPAC name: 1-[6-(benzenesulfonyl)-5-chloro-1H-benzimidazol-2-yl]pyrazole-4-carboxylic acid. InChIKey: OKGFFXCGIOKKBL-UHFFFAOYSA-N.
| Molecular formula | C17H11ClN4O4S |
|---|---|
| Molecular weight | 402.8 g/mol |
| IUPAC name | 1-[6-(benzenesulfonyl)-5-chloro-1H-benzimidazol-2-yl]pyrazole-4-carboxylic acid |
| InChIKey | OKGFFXCGIOKKBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=C(C=C3C(=C2)NC(=N3)N4C=C(C=N4)C(=O)O)Cl |
Computed by PubChem (NCBI)