CAS 1193386-52-5 is the registry number for Ethyl 1-(5-chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate (CAS 1193386-52-5) is a chemical compound with the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. IUPAC name: ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate. InChIKey: UKGWPSXLRJPKIP-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O3 |
|---|---|
| Molecular weight | 308.76 g/mol |
| IUPAC name | ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate |
| InChIKey | UKGWPSXLRJPKIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)