Products 1193387-35-7

CAS 1193387-35-7 appears in our catalog under these names: 2-Chloro-6-methoxyquinoline-5-sulfonyl chloride, 95%, 2-Chloro-6-methoxyquinoline-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

2-chloro-6-methoxyquinoline-5-sulfonyl chloride (CAS 1193387-35-7) is a chemical compound with the molecular formula C10H7Cl2NO3S and a molecular weight of 292.14 g/mol. IUPAC name: 2-chloro-6-methoxyquinoline-5-sulfonyl chloride. InChIKey: CMYLPXCZBGSNEL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7Cl2NO3S
Molecular weight292.14 g/mol
IUPAC name2-chloro-6-methoxyquinoline-5-sulfonyl chloride
InChIKeyCMYLPXCZBGSNEL-UHFFFAOYSA-N
SMILESCOC1=C(C2=C(C=C1)N=C(C=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)