Products 1193390-25-8
CAS 1193390-25-8 appears in our catalog under these names: N-[1-(4-Chlorophenyl)ethyl]cyclopropanamine hydrochloride, 95%, N-(1-(4-Chlorophenyl)ethyl)cyclopropanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[1-(4-chlorophenyl)ethyl]cyclopropanamine;hydrochloride (CAS 1193390-25-8) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: N-[1-(4-chlorophenyl)ethyl]cyclopropanamine;hydrochloride. InChIKey: YXDFHNJIWWPVBS-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | N-[1-(4-chlorophenyl)ethyl]cyclopropanamine;hydrochloride |
| InChIKey | YXDFHNJIWWPVBS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)NC2CC2.Cl |
Computed by PubChem (NCBI)