Products 1193779-36-0

CAS 1193779-36-0 is the registry number for 4-Chloro Bupropion Fumarate. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg.

Structural formula: {0} (CAS {1})

(E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one (CAS 1193779-36-0) is a chemical compound with the molecular formula C17H21Cl2NO5 and a molecular weight of 390.3 g/mol. IUPAC name: (E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one. InChIKey: CUZCRYZSIOLYOO-WLHGVMLRSA-N.

Identity
Molecular formulaC17H21Cl2NO5
Molecular weight390.3 g/mol
IUPAC name(E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one
InChIKeyCUZCRYZSIOLYOO-WLHGVMLRSA-N
SMILESCC(C(=O)C1=CC(=C(C=C1)Cl)Cl)NC(C)(C)C.C(=C/C(=O)O)\C(=O)O

Computed by PubChem (NCBI)