CAS 1193779-36-0 is the registry number for 4-Chloro Bupropion Fumarate. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg.
(E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one (CAS 1193779-36-0) is a chemical compound with the molecular formula C17H21Cl2NO5 and a molecular weight of 390.3 g/mol. IUPAC name: (E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one. InChIKey: CUZCRYZSIOLYOO-WLHGVMLRSA-N.
| Molecular formula | C17H21Cl2NO5 |
|---|---|
| Molecular weight | 390.3 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;2-(tert-butylamino)-1-(3,4-dichlorophenyl)propan-1-one |
| InChIKey | CUZCRYZSIOLYOO-WLHGVMLRSA-N |
| SMILES | CC(C(=O)C1=CC(=C(C=C1)Cl)Cl)NC(C)(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)