CAS 119379-56-5 is the registry number for trans-2,3-Bis(chloromethyl)-1,1-dibromocyclopropane. Offered by: TRC. Available pack sizes: 100mg.
Trans-(2S,3S)-1,1-dibromo-2,3-bis(chloromethyl)cyclopropane (CAS 119379-56-5) is a chemical compound with the molecular formula C5H6Br2Cl2 and a molecular weight of 296.81 g/mol. IUPAC name: trans-(2S,3S)-1,1-dibromo-2,3-bis(chloromethyl)cyclopropane. InChIKey: BZIODSPUZHMNST-QWWZWVQMSA-N.
| Molecular formula | C5H6Br2Cl2 |
|---|---|
| Molecular weight | 296.81 g/mol |
| IUPAC name | trans-(2S,3S)-1,1-dibromo-2,3-bis(chloromethyl)cyclopropane |
| InChIKey | BZIODSPUZHMNST-QWWZWVQMSA-N |
| SMILES | C([C@@H]1[C@H](C1(Br)Br)CCl)Cl |
Computed by PubChem (NCBI)