CAS 119386-82-2 is the registry number for Nonafluorohexyldimethylchlorosilane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
Chloro-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (CAS 119386-82-2) is a chemical compound with the molecular formula C8H10ClF9Si and a molecular weight of 340.69 g/mol. IUPAC name: chloro-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane. InChIKey: IHMWVSNXULAOAZ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF9Si |
|---|---|
| Molecular weight | 340.69 g/mol |
| IUPAC name | chloro-dimethyl-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| InChIKey | IHMWVSNXULAOAZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)