CAS 1194235-14-7 appears in our catalog under these names: Bortezomib Impurity 76, Bortezomib Impurity 73, N-(2-Pyrazinylcarbonyl)-L-phenylalanyl-L-phenylalanine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]propanoic acid (CAS 1194235-14-7) is a chemical compound with the molecular formula C23H22N4O4 and a molecular weight of 418.4 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]propanoic acid. InChIKey: URTCYOVFKVRVPH-OALUTQOASA-N.
| Molecular formula | C23H22N4O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | URTCYOVFKVRVPH-OALUTQOASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)C3=NC=CN=C3 |
Computed by PubChem (NCBI)