CAS 1194374-05-4 appears in our catalog under these names: Edivoxetine Hydrochloride, Edivoxetine hydrochloride, Edivoxetine (hydrochloride), 99.85%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 10mg, 5mg, 25mg, 50mg, 50 mg, 100 mg, 5 mg.
(1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol;hydrochloride (CAS 1194374-05-4) is a chemical compound with the molecular formula C18H27ClFNO4 and a molecular weight of 375.9 g/mol. IUPAC name: (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol;hydrochloride. InChIKey: WJDKGRLMNSHPON-CJRXIRLBSA-N.
| Molecular formula | C18H27ClFNO4 |
|---|---|
| Molecular weight | 375.9 g/mol |
| IUPAC name | (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol;hydrochloride |
| InChIKey | WJDKGRLMNSHPON-CJRXIRLBSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C[C@]([C@@H]2CNCCO2)(C3CCOCC3)O.Cl |
Computed by PubChem (NCBI)