CAS 1194508-25-2 appears in our catalog under these names: Edivoxetine, 98+%, Edivoxetine. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, Get quote.
(1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol (CAS 1194508-25-2) is a chemical compound with the molecular formula C18H26FNO4 and a molecular weight of 339.4 g/mol. IUPAC name: (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol. InChIKey: CPBHSHYQQLFAPW-ZWKOTPCHSA-N.
| Molecular formula | C18H26FNO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol |
| InChIKey | CPBHSHYQQLFAPW-ZWKOTPCHSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C[C@]([C@@H]2CNCCO2)(C3CCOCC3)O |
Computed by PubChem (NCBI)