Products 1194681-57-6

CAS 1194681-57-6 is the registry number for 4-(Diphenylmethyl)piperazine-1-carboximidamide sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-benzhydrylpiperazine-1-carboximidamide;sulfuric acid (CAS 1194681-57-6) is a chemical compound with the molecular formula C18H24N4O4S and a molecular weight of 392.5 g/mol. IUPAC name: 4-benzhydrylpiperazine-1-carboximidamide;sulfuric acid. InChIKey: USJUOFHYFCZXJD-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N4O4S
Molecular weight392.5 g/mol
IUPAC name4-benzhydrylpiperazine-1-carboximidamide;sulfuric acid
InChIKeyUSJUOFHYFCZXJD-UHFFFAOYSA-N
SMILESC1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)