CAS 119476-25-4 appears in our catalog under these names: 3-Benzoyl-2,5-dihydrofuran, 95%, 3-Benzoyl-2,5-dihydrofuran. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,5-dihydrofuran-3-yl(phenyl)methanone (CAS 119476-25-4) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 2,5-dihydrofuran-3-yl(phenyl)methanone. InChIKey: HFVFVLPKGRVCON-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2,5-dihydrofuran-3-yl(phenyl)methanone |
| InChIKey | HFVFVLPKGRVCON-UHFFFAOYSA-N |
| SMILES | C1C=C(CO1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)