CAS 119480-87-4 is the registry number for Carbaphosphonate. Offered by: TRC. Available pack sizes: 25mg.
(1S,3S,4S,5R)-1,3,4-trihydroxy-5-(phosphonomethyl)cyclohexane-1-carboxylic acid (CAS 119480-87-4) is a chemical compound with the molecular formula C8H15O8P and a molecular weight of 270.17 g/mol. IUPAC name: (1S,3S,4S,5R)-1,3,4-trihydroxy-5-(phosphonomethyl)cyclohexane-1-carboxylic acid. InChIKey: BKLICLLAHMTUPK-TYQACLPBSA-N.
| Molecular formula | C8H15O8P |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | (1S,3S,4S,5R)-1,3,4-trihydroxy-5-(phosphonomethyl)cyclohexane-1-carboxylic acid |
| InChIKey | BKLICLLAHMTUPK-TYQACLPBSA-N |
| SMILES | C1[C@H]([C@@H]([C@H](C[C@@]1(C(=O)O)O)O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)