CAS 1195-03-5 is the registry number for Nicotinic hydrazide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Pyridine-3-carbohydrazide;dihydrochloride (CAS 1195-03-5) is a chemical compound with the molecular formula C6H9Cl2N3O and a molecular weight of 210.06 g/mol. IUPAC name: pyridine-3-carbohydrazide;dihydrochloride. InChIKey: FMBOFMNHMFFBBD-UHFFFAOYSA-N.
| Molecular formula | C6H9Cl2N3O |
|---|---|
| Molecular weight | 210.06 g/mol |
| IUPAC name | pyridine-3-carbohydrazide;dihydrochloride |
| InChIKey | FMBOFMNHMFFBBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NN.Cl.Cl |
Computed by PubChem (NCBI)