CAS 119514-22-6 appears in our catalog under these names: 2-(4-Chlorophenyl)-5-iodo-1,3-thiazole, 98%, 2-(4-Chlorophenyl)-5-iodothiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
2-(4-chlorophenyl)-5-iodo-1,3-thiazole (CAS 119514-22-6) is a chemical compound with the molecular formula C9H5ClINS and a molecular weight of 321.57 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-iodo-1,3-thiazole. InChIKey: TVFZDKLBCLZBDB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClINS |
|---|---|
| Molecular weight | 321.57 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-iodo-1,3-thiazole |
| InChIKey | TVFZDKLBCLZBDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)I)Cl |
Computed by PubChem (NCBI)