Products 1195590-21-6

CAS 1195590-21-6 is the registry number for Methyl 2,4-dimethylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2,4-dimethylthiophene-3-carboxylate (CAS 1195590-21-6) is a chemical compound with the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. IUPAC name: methyl 2,4-dimethylthiophene-3-carboxylate. InChIKey: MUHOWMSOHAQHBH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O2S
Molecular weight170.23 g/mol
IUPAC namemethyl 2,4-dimethylthiophene-3-carboxylate
InChIKeyMUHOWMSOHAQHBH-UHFFFAOYSA-N
SMILESCC1=CSC(=C1C(=O)OC)C

Computed by PubChem (NCBI)