Products 1195670-91-7

CAS 1195670-91-7 is the registry number for Bicyclo[2.2.2]octane-1,4-diamine, hydrochloride, 90%, 90%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Bicyclo[2.2.2]octane-1,4-diamine;hydrochloride (CAS 1195670-91-7) is a chemical compound with the molecular formula C8H17ClN2 and a molecular weight of 176.69 g/mol. IUPAC name: bicyclo[2.2.2]octane-1,4-diamine;hydrochloride. InChIKey: OSHDGNFIDFGLPH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2
Molecular weight176.69 g/mol
IUPAC namebicyclo[2.2.2]octane-1,4-diamine;hydrochloride
InChIKeyOSHDGNFIDFGLPH-UHFFFAOYSA-N
SMILESC1CC2(CCC1(CC2)N)N.Cl

Computed by PubChem (NCBI)