CAS 1446424-25-4 is the registry number for (R)-1-Cyclopropylpiperidin-3-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-1-cyclopropylpiperidin-3-amine;hydrochloride (CAS 1446424-25-4) is a chemical compound with the molecular formula C8H17ClN2 and a molecular weight of 176.69 g/mol. IUPAC name: (3R)-1-cyclopropylpiperidin-3-amine;hydrochloride. InChIKey: AVZYWMQDLDCCRQ-OGFXRTJISA-N.
| Molecular formula | C8H17ClN2 |
|---|---|
| Molecular weight | 176.69 g/mol |
| IUPAC name | (3R)-1-cyclopropylpiperidin-3-amine;hydrochloride |
| InChIKey | AVZYWMQDLDCCRQ-OGFXRTJISA-N |
| SMILES | C1C[C@H](CN(C1)C2CC2)N.Cl |
Computed by PubChem (NCBI)