CAS 119577-49-0 appears in our catalog under these names: 3-Chloro-4-ethoxy-1,1,1-trifluorobut-3-en-2-one, 95%, 3-Chloro-4-ethoxy-1,1,1-trifluorobut-3-en-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
(Z)-3-chloro-4-ethoxy-1,1,1-trifluorobut-3-en-2-one (CAS 119577-49-0) is a chemical compound with the molecular formula C6H6ClF3O2 and a molecular weight of 202.56 g/mol. IUPAC name: (Z)-3-chloro-4-ethoxy-1,1,1-trifluorobut-3-en-2-one. InChIKey: SXBAUTFCZDFBIW-ARJAWSKDSA-N.
| Molecular formula | C6H6ClF3O2 |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | (Z)-3-chloro-4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | SXBAUTFCZDFBIW-ARJAWSKDSA-N |
| SMILES | CCO/C=C(/C(=O)C(F)(F)F)\Cl |
Computed by PubChem (NCBI)