CAS 1195821-09-0 appears in our catalog under these names: 2',3,5-Trifluoro-4''-propyl-[1,1':4',1''-terphenyl]-4-carboxylic acid, 95%, 95%, 2',3,5-Trifluoro-4''-propyl-[1,1':4',1''-terphenyl]-4-carboxylic acid, 95+%, 2',3,5-Trifluoro-4''-propyl-[1,1':4',1''-terphenyl]-4-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,6-difluoro-4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoic acid (CAS 1195821-09-0) is a chemical compound with the molecular formula C22H17F3O2 and a molecular weight of 370.4 g/mol. IUPAC name: 2,6-difluoro-4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoic acid. InChIKey: VJJGOAJTDWSDMB-UHFFFAOYSA-N.
| Molecular formula | C22H17F3O2 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2,6-difluoro-4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoic acid |
| InChIKey | VJJGOAJTDWSDMB-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC(=C(C(=C3)F)C(=O)O)F)F |
Computed by PubChem (NCBI)