CAS 119591-34-3 appears in our catalog under these names: 6–Iodo–1,2–benzoisothiazole–3(2H)–one1,1–dioxide, 6-Iodo-1,2-benzisothiazol-3-(2h)-one 1,1-dioxide, 95%, 6-Iodo-1,2-benzisothiazol-3-(2H)-one 1,1-dioxide, 1,2-Benzisothiazol-3(2H)-one,6-iodo-, 1,1-dioxide, 95%, 95%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 5mg, 250mg, 50mg, 0,5g.
6-iodo-1,1-dioxo-1,2-benzothiazol-3-one (CAS 119591-34-3) is a chemical compound with the molecular formula C7H4INO3S and a molecular weight of 309.08 g/mol. IUPAC name: 6-iodo-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: FUCBTVUAKSGITP-UHFFFAOYSA-N.
| Molecular formula | C7H4INO3S |
|---|---|
| Molecular weight | 309.08 g/mol |
| IUPAC name | 6-iodo-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | FUCBTVUAKSGITP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)