CAS 1196117-69-7 appears in our catalog under these names: 7-Bromodibenzo[de,h]isochromene-1,3-dione, 97%, 97%, 7-Bromodibenzo[de,h]isochromene-1,3-dione, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
8-bromo-15-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione (CAS 1196117-69-7) is a chemical compound with the molecular formula C16H7BrO3 and a molecular weight of 327.13 g/mol. IUPAC name: 8-bromo-15-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione. InChIKey: LWMIOAWWBMNDHB-UHFFFAOYSA-N.
| Molecular formula | C16H7BrO3 |
|---|---|
| Molecular weight | 327.13 g/mol |
| IUPAC name | 8-bromo-15-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
| InChIKey | LWMIOAWWBMNDHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C2Br)C=CC=C4C(=O)OC3=O |
Computed by PubChem (NCBI)