CAS 1196151-16-2 appears in our catalog under these names: Acemetacin-d4, Acemetacin–d4. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
2-[2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid (CAS 1196151-16-2) is a chemical compound with the molecular formula C21H18ClNO6 and a molecular weight of 419.8 g/mol. IUPAC name: 2-[2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid. InChIKey: FSQKKOOTNAMONP-LNFUJOGGSA-N.
| Molecular formula | C21H18ClNO6 |
|---|---|
| Molecular weight | 419.8 g/mol |
| IUPAC name | 2-[2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid |
| InChIKey | FSQKKOOTNAMONP-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)N2C(=C(C3=C2C=CC(=C3)OC)CC(=O)OCC(=O)O)C)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)