Products 1196153-31-7
CAS 1196153-31-7 is the registry number for 1,1-Dimethylethyl 3-amino-6-ethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 3-amino-6-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1196153-31-7) is a chemical compound with the molecular formula C12H20N4O2 and a molecular weight of 252.31 g/mol. IUPAC name: tert-butyl 3-amino-6-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: XPBMVQGCOXDKGN-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | tert-butyl 3-amino-6-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | XPBMVQGCOXDKGN-UHFFFAOYSA-N |
| SMILES | CCC1C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)N |
Computed by PubChem (NCBI)