CAS 1196395-85-3 is the registry number for 4-Methoxy-2-(trifluoromethoxy)phenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4,4,5,5-tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane (CAS 1196395-85-3) is a chemical compound with the molecular formula C19H20BF3O4 and a molecular weight of 380.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: UKWWUBSEEAUULO-UHFFFAOYSA-N.
| Molecular formula | C19H20BF3O4 |
|---|---|
| Molecular weight | 380.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | UKWWUBSEEAUULO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC3=CC=CC=C3)OC(F)(F)F |
Computed by PubChem (NCBI)