Products 119645-65-7
CAS 119645-65-7 appears in our catalog under these names: Z-Ala-trp-oh, 95%, Z-Ala-Trp-OH, 95+%, Z–Ala–Trp–OH, Z-Ala-Trp-OH, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 25g, 10g, 1g.
(2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 119645-65-7) is a chemical compound with the molecular formula C22H23N3O5 and a molecular weight of 409.4 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: OEANOUHCLXZBNG-LIRRHRJNSA-N.
| Molecular formula | C22H23N3O5 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | OEANOUHCLXZBNG-LIRRHRJNSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)