Products 1196507-60-4
CAS 1196507-60-4 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-3-nitro-5-(trifluoromethyl)-, 97%, 4-Chloro-3-Nitro-5-(Trifluoromethyl)-1H-Pyrrolo[2,3-b]Pyridine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1196507-60-4) is a chemical compound with the molecular formula C8H3ClF3N3O2 and a molecular weight of 265.57 g/mol. IUPAC name: 4-chloro-3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: VPSJPRMYBKNGOI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N3O2 |
|---|---|
| Molecular weight | 265.57 g/mol |
| IUPAC name | 4-chloro-3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | VPSJPRMYBKNGOI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=CN=C2N1)C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)