CAS 1196894-19-5 is the registry number for (5-(4-(tert-Butyl)phenyl)-1H-1,2,4-triazol-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(4-tert-butylphenyl)-1H-1,2,4-triazol-5-yl]methanol (CAS 1196894-19-5) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: [3-(4-tert-butylphenyl)-1H-1,2,4-triazol-5-yl]methanol. InChIKey: CESGARWFGVJUKS-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | [3-(4-tert-butylphenyl)-1H-1,2,4-triazol-5-yl]methanol |
| InChIKey | CESGARWFGVJUKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NNC(=N2)CO |
Computed by PubChem (NCBI)