CAS 119697-25-5 is the registry number for 2,2'-Diphenyl-[1,1'-binaphthalene]-4,4'-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-amino-2-phenylnaphthalen-1-yl)-3-phenylnaphthalen-1-amine (CAS 119697-25-5) is a chemical compound with the molecular formula C32H24N2 and a molecular weight of 436.5 g/mol. IUPAC name: 4-(4-amino-2-phenylnaphthalen-1-yl)-3-phenylnaphthalen-1-amine. InChIKey: CDNLZNQIDFBQML-UHFFFAOYSA-N.
| Molecular formula | C32H24N2 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 4-(4-amino-2-phenylnaphthalen-1-yl)-3-phenylnaphthalen-1-amine |
| InChIKey | CDNLZNQIDFBQML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C(=C2)N)C4=C(C=C(C5=CC=CC=C54)N)C6=CC=CC=C6 |
Computed by PubChem (NCBI)