CAS 1197-60-0 appears in our catalog under these names: 5-Methylfurmethide, 5–Methylfurmethiodide, Methylfurmethide (iodide). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 250mg, 25mg, Get quote.
Trimethyl-[(5-methylfuran-2-yl)methyl]azanium iodide (CAS 1197-60-0) is a chemical compound with the molecular formula C9H16INO and a molecular weight of 281.13 g/mol. IUPAC name: trimethyl-[(5-methylfuran-2-yl)methyl]azanium iodide. InChIKey: IHTCZSNKQINGDD-UHFFFAOYSA-M.
| Molecular formula | C9H16INO |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | trimethyl-[(5-methylfuran-2-yl)methyl]azanium iodide |
| InChIKey | IHTCZSNKQINGDD-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(O1)C[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)